Compound Q&A

How is 1-Fluoro-3-nitrobenzene (CAS: 402-67-5) typically synthesized?

Answer

1-Fluoro-3-nitrobenzene
1-Fluoro-3-nitrobenzene is typically synthesized through the nitration of 1-fluorobenzene. This process involves treating 1-fluorobenzene with a mixture of concentrated sulfuric acid and concentrated nitric acid under controlled conditions. The reaction is exothermic, and proper cooling is necessary to prevent over-nitration. The product can be isolated by extraction and recrystallization.

About

CAS No 402-67-5
English Name 1-Fluoro-3-nitrobenzene
Molecular Formula C6H4FNO2
Molecular Weight 141.1 g/mol
SMILES C1=CC(=CC(=C1)F)[N+](=O)[O-]
InChIKey WMASLRCNNKMRFP-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-3-nitrobenzene (CAS: 402-67-5)?

1-Fluoro-3-nitrobenzene (CAS: 402-67-5) is a yellow crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 1-Fluoro-3-nitrobenzene (CAS: 402-67-5)?

1-Fluoro-3-nitrobenzene (CAS: 402-67-5) is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-3-nitrobenzene (CAS: 402-67-5)?

Proper handling of 1-Fluoro-3-nitrobenzene (CAS: 402-67-5) requires the use of personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...