Compound Q&A

What are the physical and chemical properties of 1-Fluoro-3-nitrobenzene (CAS: 402-67-5)?

Answer

1-Fluoro-3-nitrobenzene
1-Fluoro-3-nitrobenzene (CAS: 402-67-5) is a yellow crystalline solid with a molecular weight of approximately 173.04 g/mol. It has a density of about 1.39 g/cm³ and a melting point of 56-57°C. This compound is slightly soluble in water but highly soluble in organic solvents like benzene and toluene. It is known for its reactivity, particularly towards nucleophilic substitution and reduction reactions.

About

CAS No 402-67-5
English Name 1-Fluoro-3-nitrobenzene
Molecular Formula C6H4FNO2
Molecular Weight 141.1 g/mol
SMILES C1=CC(=CC(=C1)F)[N+](=O)[O-]
InChIKey WMASLRCNNKMRFP-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 1-Fluoro-3-nitrobenzene (CAS: 402-67-5) typically synthesized?

1-Fluoro-3-nitrobenzene is typically synthesized through the nitration of 1-fluorobenzene. This proc...

Compound Q&A

What industries use 1-Fluoro-3-nitrobenzene (CAS: 402-67-5)?

1-Fluoro-3-nitrobenzene (CAS: 402-67-5) is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-3-nitrobenzene (CAS: 402-67-5)?

Proper handling of 1-Fluoro-3-nitrobenzene (CAS: 402-67-5) requires the use of personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...