Compound Q&A

What industries use 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9)?

Answer

4,5-Dimethoxy-2-nitrobenzaldehyde
4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) is used in various industries including pharmaceuticals, dyes, and pigments. It serves as an intermediate in the synthesis of other compounds and is also used in the development of new materials such as sensors and semiconductors.

About

CAS No 20357-25-9
English Name 4,5-Dimethoxy-2-nitrobenzaldehyde
Molecular Formula C9H9NO5
Molecular Weight 211.17 g/mol
SMILES COC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OC
InChIKey YWSPWKXREVSQCA-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9)?

4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) is a crystalline solid with a molecular weight o...

Compound Q&A

How is 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) typically synthesized?

4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) can be synthesized via the reduction of 4,5-dime...

Compound Q&A

What precautions should be taken when handling 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9)?

When handling 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...