Compound Q&A

How is 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) typically synthesized?

Answer

4,5-Dimethoxy-2-nitrobenzaldehyde
4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) can be synthesized via the reduction of 4,5-dimethoxy-2-nitrobenzoic acid with a suitable reducing agent like sodium borohydride. The reaction involves adding anhydrous sodium borohydride to a solution of the acid in a polar solvent like methanol or ethanol. The yield is typically around 85-90%, and the reaction is usually carried out under mild conditions.

About

CAS No 20357-25-9
English Name 4,5-Dimethoxy-2-nitrobenzaldehyde
Molecular Formula C9H9NO5
Molecular Weight 211.17 g/mol
SMILES COC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OC
InChIKey YWSPWKXREVSQCA-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9)?

4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9)?

4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) is used in various industries including pharmace...

Compound Q&A

What precautions should be taken when handling 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9)?

When handling 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...