Compound Q&A

What are the physical and chemical properties of 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9)?

Answer

4,5-Dimethoxy-2-nitrobenzaldehyde
4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) is a crystalline solid with a molecular weight of approximately 238.13 g/mol. It is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. Chemically, it is reactive and can undergo nitro reduction and methoxy group reactions. It is typically used in organic synthesis and as a precursor in the production of various dyes and pharmaceuticals.

About

CAS No 20357-25-9
English Name 4,5-Dimethoxy-2-nitrobenzaldehyde
Molecular Formula C9H9NO5
Molecular Weight 211.17 g/mol
SMILES COC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OC
InChIKey YWSPWKXREVSQCA-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) typically synthesized?

4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) can be synthesized via the reduction of 4,5-dime...

Compound Q&A

What industries use 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9)?

4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9) is used in various industries including pharmace...

Compound Q&A

What precautions should be taken when handling 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9)?

When handling 4,5-Dimethoxy-2-nitrobenzaldehyde (CAS: 20357-25-9), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...