Compound Q&A

What precautions should be taken when handling Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2)?

Answer

Benzyl D-alaninate 4-methylbenzenesulfonate (1:1)
When handling Benzyl D-alaninate 4-methylbenzenesulfonate, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. In case of spills, they should be cleaned up immediately using appropriate absorbent materials, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 41036-32-2
English Name Benzyl D-alaninate 4-methylbenzenesulfonate (1:1)
Molecular Formula C17H21NO5S
Molecular Weight 351.42 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.CC(C(=O)OCC1=CC=CC=C1)N
InChIKey NWOPHJSSBMABBD-DDWIOCJRSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2)?

Benzyl D-alaninate 4-methylbenzenesulfonate is a crystalline compound with a molecular weight of app...

Compound Q&A

How is Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2) typically synthesized?

Benzyl D-alaninate 4-methylbenzenesulfonate is typically synthesized by the condensation of benzyl D...

Compound Q&A

What industries use Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2)?

Benzyl D-alaninate 4-methylbenzenesulfonate is used in various industries, particularly in pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...