Compound Q&A

What industries use Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2)?

Answer

Benzyl D-alaninate 4-methylbenzenesulfonate (1:1)
Benzyl D-alaninate 4-methylbenzenesulfonate is used in various industries, particularly in pharmaceuticals, where it serves as a precursor for the synthesis of certain drugs. It is also utilized in the polymer industry for enhancing the properties of polymers, and in the sensor industry for its reactivity towards specific chemical reactions.

About

CAS No 41036-32-2
English Name Benzyl D-alaninate 4-methylbenzenesulfonate (1:1)
Molecular Formula C17H21NO5S
Molecular Weight 351.42 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.CC(C(=O)OCC1=CC=CC=C1)N
InChIKey NWOPHJSSBMABBD-DDWIOCJRSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2)?

Benzyl D-alaninate 4-methylbenzenesulfonate is a crystalline compound with a molecular weight of app...

Compound Q&A

How is Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2) typically synthesized?

Benzyl D-alaninate 4-methylbenzenesulfonate is typically synthesized by the condensation of benzyl D...

Compound Q&A

What precautions should be taken when handling Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2)?

When handling Benzyl D-alaninate 4-methylbenzenesulfonate, it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...