Compound Q&A

What are the physical and chemical properties of Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2)?

Answer

Benzyl D-alaninate 4-methylbenzenesulfonate (1:1)
Benzyl D-alaninate 4-methylbenzenesulfonate is a crystalline compound with a molecular weight of approximately 383.47 g/mol. It has a high solubility in water and organic solvents. Chemically, it exhibits basic properties due to the amine group and is reactive towards acid and base conditions. It crystallizes in the monoclinic system and shows good stability under normal conditions.

About

CAS No 41036-32-2
English Name Benzyl D-alaninate 4-methylbenzenesulfonate (1:1)
Molecular Formula C17H21NO5S
Molecular Weight 351.42 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.CC(C(=O)OCC1=CC=CC=C1)N
InChIKey NWOPHJSSBMABBD-DDWIOCJRSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2) typically synthesized?

Benzyl D-alaninate 4-methylbenzenesulfonate is typically synthesized by the condensation of benzyl D...

Compound Q&A

What industries use Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2)?

Benzyl D-alaninate 4-methylbenzenesulfonate is used in various industries, particularly in pharmaceu...

Compound Q&A

What precautions should be taken when handling Benzyl D-alaninate 4-methylbenzenesulfonate (CAS: 41036-32-2)?

When handling Benzyl D-alaninate 4-methylbenzenesulfonate, it is crucial to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...