Compound Q&A

What industries use 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8)?

Answer

5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate
5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate is primarily used in the pharmaceutical industry for the development of novel drugs and in the polymer industry for the synthesis of advanced materials. It also finds applications in the development of sensors and as a precursor in semiconductor manufacturing. The compound’s unique chemical structure makes it suitable for various advanced chemical applications requiring high purity and specific functionalities.

About

CAS No 99740-00-8
English Name 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate
Molecular Formula C20H20N2O4S
Molecular Weight 384.46 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)NC(C)C(=O)OC2=CNC(=C2)C3=CC=CC=C3
InChIKey VZALJYJCTCKOHO-HNNXBMFYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8)?

5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate is a crystalline compound with a molec...

Compound Q&A

How is 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8) typically synthesized?

5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate is typically synthesized through a mul...

Compound Q&A

What precautions should be taken when handling 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8)?

When handling 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...