Compound Q&A

What are the physical and chemical properties of 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8)?

Answer

5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate
5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate is a crystalline compound with a molecular weight of approximately 333.37 g/mol. It has good solubility in organic solvents such as dichloromethane and poor solubility in water. The compound is chemically stable under normal conditions but may react with strong acids and bases. It is insoluble in aqueous solutions and has limited reactivity in general.

About

CAS No 99740-00-8
English Name 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate
Molecular Formula C20H20N2O4S
Molecular Weight 384.46 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)NC(C)C(=O)OC2=CNC(=C2)C3=CC=CC=C3
InChIKey VZALJYJCTCKOHO-HNNXBMFYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8) typically synthesized?

5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate is typically synthesized through a mul...

Compound Q&A

What industries use 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8)?

5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8)?

When handling 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...