Compound Q&A

How is 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8) typically synthesized?

Answer

5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate
5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate is typically synthesized through a multi-step process involving the reaction of 5-phenyl-1H-pyrrole with 4-methylphenylsulfonyl chloride followed by coupling with alanine. The synthesis usually employs conditions that favor the formation of the desired product, with high selectivity and yield. Commonly used catalysts include triethylamine and HOBt (1-Hydroxybenzotriazole), which enhance the chemical reaction and improve the yield.

About

CAS No 99740-00-8
English Name 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate
Molecular Formula C20H20N2O4S
Molecular Weight 384.46 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)NC(C)C(=O)OC2=CNC(=C2)C3=CC=CC=C3
InChIKey VZALJYJCTCKOHO-HNNXBMFYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8)?

5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate is a crystalline compound with a molec...

Compound Q&A

What industries use 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8)?

5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate (CAS: 99740-00-8)?

When handling 5-Phenyl-1H-pyrrol-3-yl N-[(4-methylphenyl)sulfonyl]alaninate, it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...