Compound Q&A

How is Vapreotide (CAS: 103222-11-3) typically synthesized?

Answer

Vapreotide
Vapreotide (CAS: 103222-11-3) is typically synthesized via solid-phase peptide synthesis (SPPS). Commonly, the peptide is built using Fmoc chemistry with a protected amino acid resin. The synthesis involves stepwise coupling of protected amino acids, removal of the protecting groups, and final deprotection to yield the active peptide. The yield and purity are typically high, with efficient removal of by-products and side-products.

About

English Name Vapreotide
Molecular Formula C57H70N12O9S2
Molecular Weight 1131.4 g/mol
SMILES CC(C)C1C(=O)NC(CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCCN)CC2=CNC3=CC=CC=C32)CC4=CC=C(C=C4)O)NC(=O)C(CC5=CC=CC=C5)N)C(=O)NC(CC6=CNC7=CC=CC=C76)C(=O)N
InChIKey SWXOGPJRIDTIRL-DOUNNPEJSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of Vapreotide (CAS: 103222-11-3)?

Vapreotide (CAS: 103222-11-3) is a cyclic octapeptide with a molecular weight of approximately 1089....

Compound Q&A

What industries use Vapreotide (CAS: 103222-11-3)?

Vapreotide (CAS: 103222-11-3) is primarily used in the pharmaceutical industry. It is approved for t...

Compound Q&A

What precautions should be taken when handling Vapreotide (CAS: 103222-11-3)?

When handling Vapreotide (CAS: 103222-11-3), it is important to use appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...