Compound Q&A

What are the physical and chemical properties of 1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (CAS: 56776-01-3)?

Answer

1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (1:1)
1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride is a white crystalline solid with a molecular weight of approximately 313.7 g/mol. It has a pKa of about 7.5 and is soluble in water and ethanol. This compound is characterized by its low reactivity under normal conditions but can undergo hydrolysis in basic conditions. It has a hydrochloride salt form, which enhances its stability and solubility.

About

CAS No 56776-01-3
English Name 1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (1:1)
Molecular Formula C12H19Cl2NO
Molecular Weight 264.19 g/mol
SMILES CC(C)(C)NCC(C1=CC=CC=C1Cl)O.Cl
InChIKey RSLNRVYIRDVHLY-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (CAS: 56776-01-3) typically synthesized?

1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride is typically synthesized by t...

Compound Q&A

What industries use 1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (CAS: 56776-01-3)?

1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride (CAS: 56776-01-3)?

When handling 1-(2-Chlorophenyl)-2-[(2-methyl-2-propanyl)amino]ethanol hydrochloride, ensure the use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...