Compound Q&A

What industries use tert-butyl 4-aminobenzoate (CAS: 18144-47-3)?

Answer

tert-butyl 4-aminobenzoate
Tert-butyl 4-aminobenzoate (CAS: 18144-47-3) is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drug molecules. It is also used in the polymer industry for improving the thermal stability of polymers. Additionally, it finds applications in the production of sensors and as a chemical reagent.

About

CAS No 18144-47-3
English Name tert-butyl 4-aminobenzoate
Molecular Formula C11H15NO2
Molecular Weight 193.25 g/mol
SMILES CC(C)(C)OC(=O)C1=CC=C(C=C1)N
InChIKey KYORUZMJUKHKFS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-butyl 4-aminobenzoate (CAS: 18144-47-3)?

Tert-butyl 4-aminobenzoate (CAS: 18144-47-3) is a white crystalline solid with a molecular weight of...

Compound Q&A

How is tert-butyl 4-aminobenzoate (CAS: 18144-47-3) typically synthesized?

Tert-butyl 4-aminobenzoate is typically synthesized via the reaction of 4-bromobenzoic acid with ter...

Compound Q&A

What precautions should be taken when handling tert-butyl 4-aminobenzoate (CAS: 18144-47-3)?

When handling tert-butyl 4-aminobenzoate (CAS: 18144-47-3), it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...