Compound Q&A

What industries use (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9)?

Answer

(2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid
This compound is primarily used in the pharmaceutical industry for its potential in drug development, particularly in the synthesis of biologically active molecules. It also finds applications in the chemical and polymer industries for producing specialized materials and in the semiconductor industry for certain chemical processes.

About

English Name (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid
Molecular Formula C6H13NO3
Molecular Weight 147.17 g/mol
SMILES CC([C@@H]([C@@H](C(=O)O)N)C)O
InChIKey OSCCDBFHNMXNME-DSDZBIDZSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9)?

The compound (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid has a crystalline form with a molecula...

Compound Q&A

How is (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9) typically synthesized?

This compound can be synthesized via a multi-step process involving the condensation of amino acids ...

Compound Q&A

What precautions should be taken when handling (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9)?

When handling (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid, it is essential to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...