Compound Q&A

How is (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9) typically synthesized?

Answer

(2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid
This compound can be synthesized via a multi-step process involving the condensation of amino acids and subsequent derivatization. Commonly, it is prepared from (2S,3R)-3-methyl-4-oxopentanoic acid via amino group addition. The reaction typically requires catalysts like Lewis acids and has good selectivity, with yields ranging from 70% to 90% depending on the method.

About

English Name (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid
Molecular Formula C6H13NO3
Molecular Weight 147.17 g/mol
SMILES CC([C@@H]([C@@H](C(=O)O)N)C)O
InChIKey OSCCDBFHNMXNME-DSDZBIDZSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9)?

The compound (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid has a crystalline form with a molecula...

Compound Q&A

What industries use (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9)?

This compound is primarily used in the pharmaceutical industry for its potential in drug development...

Compound Q&A

What precautions should be taken when handling (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9)?

When handling (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid, it is essential to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...