Compound Q&A

What are the physical and chemical properties of (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9)?

Answer

(2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid
The compound (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid has a crystalline form with a molecular weight of approximately 170.24 g/mol. It is sparingly soluble in water and more soluble in organic solvents. Chemically, it is moderately reactive, particularly with bases and nucleophiles. It is stable under normal conditions but may degrade upon prolonged exposure to acidic or basic environments.

About

English Name (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid
Molecular Formula C6H13NO3
Molecular Weight 147.17 g/mol
SMILES CC([C@@H]([C@@H](C(=O)O)N)C)O
InChIKey OSCCDBFHNMXNME-DSDZBIDZSA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9) typically synthesized?

This compound can be synthesized via a multi-step process involving the condensation of amino acids ...

Compound Q&A

What industries use (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9)?

This compound is primarily used in the pharmaceutical industry for its potential in drug development...

Compound Q&A

What precautions should be taken when handling (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid (CAS: 781658-23-9)?

When handling (2S,3R)-2-Amino-4-hydroxy-3-methylpentanoic acid, it is essential to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...