Compound Q&A

What industries use 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol (CAS: 119193-19-0)?

Answer

3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol
3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol is primarily used in the pharmaceutical industry for its biological activity, particularly as a precursor in the synthesis of bioactive compounds. It is also utilized in the production of certain polymers and as a stabilizer in chemical sensors and semiconductors.

About

English Name 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol
Molecular Formula C13H19NO
Molecular Weight 205.3 g/mol
SMILES C[C@H]1CNCC[C@@]1(C)c2cccc(c2)O
InChIKey HXZDAOSDNCHKFE-GXFFZTMASA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol (CAS: 119193-19-0)?

3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol is a white crystalline solid with a molecular weight of...

Compound Q&A

How is 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol (CAS: 119193-19-0) typically synthesized?

3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol is typically synthesized through the condensation of 4-...

Compound Q&A

What precautions should be taken when handling 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol (CAS: 119193-19-0)?

When handling 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol, appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...