Compound Q&A

What are the physical and chemical properties of 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol (CAS: 119193-19-0)?

Answer

3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol
3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol is a white crystalline solid with a molecular weight of approximately 268.37 g/mol. It has low water solubility and is soluble in organic solvents such as ethanol and acetone. This compound exhibits moderate reactivity, particularly towards acidic or basic conditions, and shows stability under normal storage conditions.

About

English Name 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol
Molecular Formula C13H19NO
Molecular Weight 205.3 g/mol
SMILES C[C@H]1CNCC[C@@]1(C)c2cccc(c2)O
InChIKey HXZDAOSDNCHKFE-GXFFZTMASA-N
Last Updated: 2025-09-07 10:19

Related Q&A

Compound Q&A

How is 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol (CAS: 119193-19-0) typically synthesized?

3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol is typically synthesized through the condensation of 4-...

Compound Q&A

What industries use 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol (CAS: 119193-19-0)?

3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol is primarily used in the pharmaceutical industry for it...

Compound Q&A

What precautions should be taken when handling 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol (CAS: 119193-19-0)?

When handling 3-[(3R,4R)-3,4-Dimethyl-4-piperidinyl]phenol, appropriate personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...