Compound Q&A

What industries use 3-nitropyridin-2-amine (CAS: 4214-75-9)?

Answer

3-nitropyridin-2-amine
3-nitropyridin-2-amine (CAS: 4214-75-9) finds applications in various industries. It is used in pharmaceuticals for the synthesis of certain drugs, particularly in the development of anticancer and anti-inflammatory agents. It is also used in the polymer industry for the modification of polymers to improve their properties. Additionally, it has applications in the sensor and semiconductor industries due to its reactive functional groups.

About

CAS No 4214-75-9
English Name 3-nitropyridin-2-amine
Molecular Formula C5H5N3O2
Molecular Weight 139.11 g/mol
SMILES C1=CC(=C(N=C1)N)[N+](=O)[O-]
InChIKey BPYHGTCRXDWOIQ-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-nitropyridin-2-amine (CAS: 4214-75-9)?

3-nitropyridin-2-amine (CAS: 4214-75-9) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

How is 3-nitropyridin-2-amine (CAS: 4214-75-9) typically synthesized?

3-nitropyridin-2-amine can be synthesized via a multi-step process. Common methods include the reduc...

Compound Q&A

What precautions should be taken when handling 3-nitropyridin-2-amine (CAS: 4214-75-9)?

When handling 3-nitropyridin-2-amine (CAS: 4214-75-9), it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...