Compound Q&A

How is 3-nitropyridin-2-amine (CAS: 4214-75-9) typically synthesized?

Answer

3-nitropyridin-2-amine
3-nitropyridin-2-amine can be synthesized via a multi-step process. Common methods include the reduction of 3-nitropyridine with a suitable reducing agent such as sodium borohydride. The overall reaction involves the formation of the amine from the nitro group, and the process typically achieves a yield of around 70-80%. Catalysts such as palladium on carbon can be used to improve the efficiency of the reduction.

About

CAS No 4214-75-9
English Name 3-nitropyridin-2-amine
Molecular Formula C5H5N3O2
Molecular Weight 139.11 g/mol
SMILES C1=CC(=C(N=C1)N)[N+](=O)[O-]
InChIKey BPYHGTCRXDWOIQ-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-nitropyridin-2-amine (CAS: 4214-75-9)?

3-nitropyridin-2-amine (CAS: 4214-75-9) is a crystalline compound with a molecular weight of approxi...

Compound Q&A

What industries use 3-nitropyridin-2-amine (CAS: 4214-75-9)?

3-nitropyridin-2-amine (CAS: 4214-75-9) finds applications in various industries. It is used in phar...

Compound Q&A

What precautions should be taken when handling 3-nitropyridin-2-amine (CAS: 4214-75-9)?

When handling 3-nitropyridin-2-amine (CAS: 4214-75-9), it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...