Compound Q&A

What precautions should be taken when handling 2-Triphenylenylboronic acid (CAS: 654664-63-8)?

Answer

2-Triphenylenylboronic acid
When handling 2-Triphenylenylboronic acid, it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize exposure. Spills should be cleaned up carefully, and proper safety data sheets (SDS) should be consulted for detailed handling and disposal instructions.

About

English Name 2-Triphenylenylboronic acid
Molecular Formula C18H13BO2
Molecular Weight 272.11 g/mol
SMILES OB(C1=CC=C2C3=CC=CC=C3C4=CC=CC=C4C2=C1)O
InChIKey PXFBSZZEOWJJNL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Triphenylenylboronic acid (CAS: 654664-63-8)?

2-Triphenylenylboronic acid is a crystalline solid with a molecular weight of approximately 648.5 g/...

Compound Q&A

How is 2-Triphenylenylboronic acid (CAS: 654664-63-8) typically synthesized?

2-Triphenylenylboronic acid can be synthesized through the reaction of triphenylene with tributylbor...

Compound Q&A

What industries use 2-Triphenylenylboronic acid (CAS: 654664-63-8)?

2-Triphenylenylboronic acid is used in various industries, particularly in the pharmaceutical sector...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...