Compound Q&A

What industries use 2-Triphenylenylboronic acid (CAS: 654664-63-8)?

Answer

2-Triphenylenylboronic acid
2-Triphenylenylboronic acid is used in various industries, particularly in the pharmaceutical sector for drug development, and in materials science for the synthesis of advanced polymers and sensors. Its unique structure makes it valuable for creating novel materials with specific properties required in semiconductor technology.

About

English Name 2-Triphenylenylboronic acid
Molecular Formula C18H13BO2
Molecular Weight 272.11 g/mol
SMILES OB(C1=CC=C2C3=CC=CC=C3C4=CC=CC=C4C2=C1)O
InChIKey PXFBSZZEOWJJNL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Triphenylenylboronic acid (CAS: 654664-63-8)?

2-Triphenylenylboronic acid is a crystalline solid with a molecular weight of approximately 648.5 g/...

Compound Q&A

How is 2-Triphenylenylboronic acid (CAS: 654664-63-8) typically synthesized?

2-Triphenylenylboronic acid can be synthesized through the reaction of triphenylene with tributylbor...

Compound Q&A

What precautions should be taken when handling 2-Triphenylenylboronic acid (CAS: 654664-63-8)?

When handling 2-Triphenylenylboronic acid, it is important to use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...