Compound Q&A

What are the physical and chemical properties of 2-Triphenylenylboronic acid (CAS: 654664-63-8)?

Answer

2-Triphenylenylboronic acid
2-Triphenylenylboronic acid is a crystalline solid with a molecular weight of approximately 648.5 g/mol. It is poorly soluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable under typical reaction conditions but can undergo substitution reactions with nucleophiles. It is often used in organic synthesis for its reactivity with boron-atom containing reagents.

About

English Name 2-Triphenylenylboronic acid
Molecular Formula C18H13BO2
Molecular Weight 272.11 g/mol
SMILES OB(C1=CC=C2C3=CC=CC=C3C4=CC=CC=C4C2=C1)O
InChIKey PXFBSZZEOWJJNL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is 2-Triphenylenylboronic acid (CAS: 654664-63-8) typically synthesized?

2-Triphenylenylboronic acid can be synthesized through the reaction of triphenylene with tributylbor...

Compound Q&A

What industries use 2-Triphenylenylboronic acid (CAS: 654664-63-8)?

2-Triphenylenylboronic acid is used in various industries, particularly in the pharmaceutical sector...

Compound Q&A

What precautions should be taken when handling 2-Triphenylenylboronic acid (CAS: 654664-63-8)?

When handling 2-Triphenylenylboronic acid, it is important to use appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...