Compound Q&A

What industries use 6-chloro-2-methyl-3-nitropyridine (CAS: 22280-60-0)?

Answer

6-chloro-2-methyl-3-nitropyridine
6-Chloro-2-methyl-3-nitropyridine is used in the pharmaceutical industry for the synthesis of certain drugs due to its antibacterial and antifungal properties. It also finds applications in the polymer industry for the development of advanced materials. Additionally, it is utilized in the semiconductor industry for fabrication processes and in sensors for detecting specific chemical species.

About

CAS No 22280-60-0
English Name 6-chloro-2-methyl-3-nitropyridine
Molecular Formula C6H5ClN2O2
Molecular Weight 172.57 g/mol
SMILES CC1=C(C=CC(=N1)Cl)[N+](=O)[O-]
InChIKey GHSRMSJVYMITDX-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-chloro-2-methyl-3-nitropyridine (CAS: 22280-60-0)?

6-Chloro-2-methyl-3-nitropyridine is a crystalline solid with a molecular weight of approximately 19...

Compound Q&A

How is 6-chloro-2-methyl-3-nitropyridine (CAS: 22280-60-0) typically synthesized?

6-Chloro-2-methyl-3-nitropyridine can be synthesized via nitration of 2-methyl-3-chloropyridine usin...

Compound Q&A

What precautions should be taken when handling 6-chloro-2-methyl-3-nitropyridine (CAS: 22280-60-0)?

Handling 6-chloro-2-methyl-3-nitropyridine requires strict safety measures. Always wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...