Compound Q&A

How is 6-chloro-2-methyl-3-nitropyridine (CAS: 22280-60-0) typically synthesized?

Answer

6-chloro-2-methyl-3-nitropyridine
6-Chloro-2-methyl-3-nitropyridine can be synthesized via nitration of 2-methyl-3-chloropyridine using nitric acid in the presence of concentrated sulfuric acid as a catalyst. The reaction is carried out under controlled conditions to achieve high selectivity and yield. This method ensures the formation of the desired nitro derivative while minimizing side reactions.

About

CAS No 22280-60-0
English Name 6-chloro-2-methyl-3-nitropyridine
Molecular Formula C6H5ClN2O2
Molecular Weight 172.57 g/mol
SMILES CC1=C(C=CC(=N1)Cl)[N+](=O)[O-]
InChIKey GHSRMSJVYMITDX-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-chloro-2-methyl-3-nitropyridine (CAS: 22280-60-0)?

6-Chloro-2-methyl-3-nitropyridine is a crystalline solid with a molecular weight of approximately 19...

Compound Q&A

What industries use 6-chloro-2-methyl-3-nitropyridine (CAS: 22280-60-0)?

6-Chloro-2-methyl-3-nitropyridine is used in the pharmaceutical industry for the synthesis of certai...

Compound Q&A

What precautions should be taken when handling 6-chloro-2-methyl-3-nitropyridine (CAS: 22280-60-0)?

Handling 6-chloro-2-methyl-3-nitropyridine requires strict safety measures. Always wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...