Compound Q&A

What precautions should be taken when handling p-Toluenesulfonyl azide (CAS: 941-55-9)?

Answer

p-Toluenesulfonyl azide
When handling p-Toluenesulfonyl azide (CAS: 941-55-9), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The substance should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always consult a Safety Data Sheet (SDS) for detailed safety instructions and emergency procedures.

About

CAS No 941-55-9
English Name p-Toluenesulfonyl azide
Molecular Formula C7H7N3O2S
Molecular Weight 197.21 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)N=[N+]=[N-]
InChIKey NDLIRBZKZSDGSO-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of p-Toluenesulfonyl azide (CAS: 941-55-9)?

p-Toluenesulfonyl azide (CAS: 941-55-9) is a crystalline white solid with a molecular weight of appr...

Compound Q&A

How is p-Toluenesulfonyl azide (CAS: 941-55-9) typically synthesized?

p-Toluenesulfonyl azide is typically synthesized by the reaction of toluenesulfonyl chloride with so...

Compound Q&A

What industries use p-Toluenesulfonyl azide (CAS: 941-55-9)?

p-Toluenesulfonyl azide (CAS: 941-55-9) is primarily used in the pharmaceutical industry for the syn...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...