Compound Q&A

What industries use p-Toluenesulfonyl azide (CAS: 941-55-9)?

Answer

p-Toluenesulfonyl azide
p-Toluenesulfonyl azide (CAS: 941-55-9) is primarily used in the pharmaceutical industry for the synthesis of various biologically active compounds. It is also utilized in the polymer industry for the modification of polymers and in the development of sensors and semiconductors due to its reactivity and functional groups.

About

CAS No 941-55-9
English Name p-Toluenesulfonyl azide
Molecular Formula C7H7N3O2S
Molecular Weight 197.21 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)N=[N+]=[N-]
InChIKey NDLIRBZKZSDGSO-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of p-Toluenesulfonyl azide (CAS: 941-55-9)?

p-Toluenesulfonyl azide (CAS: 941-55-9) is a crystalline white solid with a molecular weight of appr...

Compound Q&A

How is p-Toluenesulfonyl azide (CAS: 941-55-9) typically synthesized?

p-Toluenesulfonyl azide is typically synthesized by the reaction of toluenesulfonyl chloride with so...

Compound Q&A

What precautions should be taken when handling p-Toluenesulfonyl azide (CAS: 941-55-9)?

When handling p-Toluenesulfonyl azide (CAS: 941-55-9), it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...