Compound Q&A

What precautions should be taken when handling 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8)?

Answer

2,4-Dichlorobenzoyl chloride
When handling 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8), it is essential to wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. It should be handled under a fume hood due to its strong volatility and reactivity. Proper spill handling procedures should be followed, and the Material Safety Data Sheet (MSDS) should be consulted for detailed safety information.

About

CAS No 89-75-8
English Name 2,4-Dichlorobenzoyl chloride
Molecular Formula C7H3Cl3O
Molecular Weight 209.46 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C(=O)Cl
InChIKey CEOCVKWBUWKBKA-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8)?

2,4-Dichlorobenzoyl chloride (CAS: 89-75-8) is a white crystalline solid with a molecular weight of ...

Compound Q&A

How is 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8) typically synthesized?

2,4-Dichlorobenzoyl chloride is typically synthesized by the reaction of 2,4-dichlorobenzoic acid wi...

Compound Q&A

What industries use 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8)?

2,4-Dichlorobenzoyl chloride is used in the pharmaceutical industry for the synthesis of active phar...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...