Compound Q&A

How is 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8) typically synthesized?

Answer

2,4-Dichlorobenzoyl chloride
2,4-Dichlorobenzoyl chloride is typically synthesized by the reaction of 2,4-dichlorobenzoic acid with thionyl chloride. The reaction is carried out under anhydrous conditions to improve yield and selectivity. Additional methods include the chlorination of benzoic acid or 2,4-dichlorobenzoic acid with phosphorus oxychloride or phosphorus chlorochloridate.

About

CAS No 89-75-8
English Name 2,4-Dichlorobenzoyl chloride
Molecular Formula C7H3Cl3O
Molecular Weight 209.46 g/mol
SMILES C1=CC(=C(C=C1Cl)Cl)C(=O)Cl
InChIKey CEOCVKWBUWKBKA-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8)?

2,4-Dichlorobenzoyl chloride (CAS: 89-75-8) is a white crystalline solid with a molecular weight of ...

Compound Q&A

What industries use 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8)?

2,4-Dichlorobenzoyl chloride is used in the pharmaceutical industry for the synthesis of active phar...

Compound Q&A

What precautions should be taken when handling 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8)?

When handling 2,4-Dichlorobenzoyl chloride (CAS: 89-75-8), it is essential to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...