Compound Q&A

What precautions should be taken when handling Sanggenon C (CAS: 80651-76-9)?

Answer

Sanggenon C
When handling Sanggenon C (CAS: 80651-76-9), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. Work should be conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for detailed spill procedures.

About

CAS No 80651-76-9
English Name Sanggenon C
Molecular Formula C40H36O12
Molecular Weight 708.71 g/mol
SMILES CC(=CC[C@@]12Oc3cc(O)c(c(c3C(=O)[C@@]2(O)Oc2c1ccc(c2)O)O)[C@H]1C=C(C)C[C@@H]([C@H]1C(=O)c1ccc(cc1O)O)c1ccc(cc1O)O)C
InChIKey XETHJOZXBVWLLM-HUKCQOFTSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sanggenon C (CAS: 80651-76-9)?

Sanggenon C (CAS: 80651-76-9) is a crystalline compound with a molecular weight of approximately 416...

Compound Q&A

How is Sanggenon C (CAS: 80651-76-9) typically synthesized?

Sanggenon C (CAS: 80651-76-9) is synthesized through a series of organic reactions, including conden...

Compound Q&A

What industries use Sanggenon C (CAS: 80651-76-9)?

Sanggenon C (CAS: 80651-76-9) is primarily used in the pharmaceutical industry for its potential the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...