Compound Q&A

How is Sanggenon C (CAS: 80651-76-9) typically synthesized?

Answer

Sanggenon C
Sanggenon C (CAS: 80651-76-9) is synthesized through a series of organic reactions, including condensation, reduction, and cyclization. Common catalysts include palladium(II) acetate and triphenylphosphine. The synthesis typically yields about 70-80% purity, with high selectivity towards the desired product.

About

CAS No 80651-76-9
English Name Sanggenon C
Molecular Formula C40H36O12
Molecular Weight 708.71 g/mol
SMILES CC(=CC[C@@]12Oc3cc(O)c(c(c3C(=O)[C@@]2(O)Oc2c1ccc(c2)O)O)[C@H]1C=C(C)C[C@@H]([C@H]1C(=O)c1ccc(cc1O)O)c1ccc(cc1O)O)C
InChIKey XETHJOZXBVWLLM-HUKCQOFTSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sanggenon C (CAS: 80651-76-9)?

Sanggenon C (CAS: 80651-76-9) is a crystalline compound with a molecular weight of approximately 416...

Compound Q&A

What industries use Sanggenon C (CAS: 80651-76-9)?

Sanggenon C (CAS: 80651-76-9) is primarily used in the pharmaceutical industry for its potential the...

Compound Q&A

What precautions should be taken when handling Sanggenon C (CAS: 80651-76-9)?

When handling Sanggenon C (CAS: 80651-76-9), it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...