Compound Q&A

What are the physical and chemical properties of Sanggenon C (CAS: 80651-76-9)?

Answer

Sanggenon C
Sanggenon C (CAS: 80651-76-9) is a crystalline compound with a molecular weight of approximately 416.5 g/mol. It is slightly soluble in water and organic solvents. Chemically, it is relatively stable but can react with strong oxidizers. Its solubility and reactivity make it useful in pharmaceutical applications.

About

CAS No 80651-76-9
English Name Sanggenon C
Molecular Formula C40H36O12
Molecular Weight 708.71 g/mol
SMILES CC(=CC[C@@]12Oc3cc(O)c(c(c3C(=O)[C@@]2(O)Oc2c1ccc(c2)O)O)[C@H]1C=C(C)C[C@@H]([C@H]1C(=O)c1ccc(cc1O)O)c1ccc(cc1O)O)C
InChIKey XETHJOZXBVWLLM-HUKCQOFTSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is Sanggenon C (CAS: 80651-76-9) typically synthesized?

Sanggenon C (CAS: 80651-76-9) is synthesized through a series of organic reactions, including conden...

Compound Q&A

What industries use Sanggenon C (CAS: 80651-76-9)?

Sanggenon C (CAS: 80651-76-9) is primarily used in the pharmaceutical industry for its potential the...

Compound Q&A

What precautions should be taken when handling Sanggenon C (CAS: 80651-76-9)?

When handling Sanggenon C (CAS: 80651-76-9), it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...