Compound Q&A

What industries use 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0)?

Answer

3-Amino-4-methoxybenzenesulfonic acid
3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) is primarily used in the pharmaceutical industry for the synthesis of drugs, particularly those that require specific functional groups for bioactivity. It is also found in polymer production, where its functional groups can enhance material properties. Additionally, it is employed in sensors and semiconductors for its reactivity and stability.

About

CAS No 98-42-0
English Name 3-Amino-4-methoxybenzenesulfonic acid
Molecular Formula C7H9NO4S
Molecular Weight 203.22 g/mol
SMILES COC1=C(C=C(C=C1)S(=O)(=O)O)N
InChIKey FLIOATBXVNLPLK-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0)?

3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) is a white to pale yellow crystalline solid wit...

Compound Q&A

How is 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) typically synthesized?

3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) can be synthesized via the sulfonation of 4-met...

Compound Q&A

What precautions should be taken when handling 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0)?

When handling 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...