Compound Q&A

What are the physical and chemical properties of 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0)?

Answer

3-Amino-4-methoxybenzenesulfonic acid
3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) is a white to pale yellow crystalline solid with a molecular weight of approximately 237.19 g/mol. It has a solubility of about 2.6 g/L in water at 20°C. Chemically, it is moderately reactive, particularly with bases and nucleophiles. It is commonly used in analytical chemistry and pharmaceuticals due to its unique functional groups.

About

CAS No 98-42-0
English Name 3-Amino-4-methoxybenzenesulfonic acid
Molecular Formula C7H9NO4S
Molecular Weight 203.22 g/mol
SMILES COC1=C(C=C(C=C1)S(=O)(=O)O)N
InChIKey FLIOATBXVNLPLK-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) typically synthesized?

3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) can be synthesized via the sulfonation of 4-met...

Compound Q&A

What industries use 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0)?

3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0)?

When handling 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...