Compound Q&A

How is 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) typically synthesized?

Answer

3-Amino-4-methoxybenzenesulfonic acid
3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) can be synthesized via the sulfonation of 4-methoxyaniline followed by coupling with benzenesulfonyl chloride. The reaction typically involves the use of a phase transfer catalyst and requires careful control of the reaction conditions to achieve high yield and selectivity. The overall process is moderately complex but straightforward for experienced chemists.

About

CAS No 98-42-0
English Name 3-Amino-4-methoxybenzenesulfonic acid
Molecular Formula C7H9NO4S
Molecular Weight 203.22 g/mol
SMILES COC1=C(C=C(C=C1)S(=O)(=O)O)N
InChIKey FLIOATBXVNLPLK-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0)?

3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) is a white to pale yellow crystalline solid wit...

Compound Q&A

What industries use 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0)?

3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0) is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0)?

When handling 3-Amino-4-methoxybenzenesulfonic acid (CAS: 98-42-0), it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...