Compound Q&A

What industries use 2,2'-Disulfanediyldianiline (CAS: 1141-88-4)?

Answer

2,2'-Disulfanediyldianiline
2,2'-Disulfanediyldianiline (CAS: 1141-88-4) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry as a precursor for polymeric materials. Additionally, it is used in the development of sensors and semiconductors due to its unique electronic properties. Its use in these industries highlights its versatility and importance in chemical research and manufacturing.

About

CAS No 1141-88-4
English Name 2,2'-Disulfanediyldianiline
Molecular Formula C12H12N2S2
Molecular Weight 248.38 g/mol
SMILES C1=CC=C(C(=C1)N)SSC2=CC=CC=C2N
InChIKey YYYOQURZQWIILK-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Disulfanediyldianiline (CAS: 1141-88-4)?

2,2'-Disulfanediyldianiline (CAS: 1141-88-4) is a white to light yellow crystalline solid with a mol...

Compound Q&A

How is 2,2'-Disulfanediyldianiline (CAS: 1141-88-4) typically synthesized?

2,2'-Disulfanediyldianiline (CAS: 1141-88-4) is typically synthesized through the reaction of anilin...

Compound Q&A

What precautions should be taken when handling 2,2'-Disulfanediyldianiline (CAS: 1141-88-4)?

When handling 2,2'-Disulfanediyldianiline (CAS: 1141-88-4), it is crucial to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...