Compound Q&A

What are the physical and chemical properties of 2,2'-Disulfanediyldianiline (CAS: 1141-88-4)?

Answer

2,2'-Disulfanediyldianiline
2,2'-Disulfanediyldianiline (CAS: 1141-88-4) is a white to light yellow crystalline solid with a molecular weight of approximately 212.24 g/mol. It has limited solubility in water but is more soluble in organic solvents like ethanol and acetone. This compound is known for its reactivity towards nucleophiles, particularly due to the presence of the sulfide groups. It tends to react with amines and thiols, making it useful in various chemical syntheses.

About

CAS No 1141-88-4
English Name 2,2'-Disulfanediyldianiline
Molecular Formula C12H12N2S2
Molecular Weight 248.38 g/mol
SMILES C1=CC=C(C(=C1)N)SSC2=CC=CC=C2N
InChIKey YYYOQURZQWIILK-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is 2,2'-Disulfanediyldianiline (CAS: 1141-88-4) typically synthesized?

2,2'-Disulfanediyldianiline (CAS: 1141-88-4) is typically synthesized through the reaction of anilin...

Compound Q&A

What industries use 2,2'-Disulfanediyldianiline (CAS: 1141-88-4)?

2,2'-Disulfanediyldianiline (CAS: 1141-88-4) is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2,2'-Disulfanediyldianiline (CAS: 1141-88-4)?

When handling 2,2'-Disulfanediyldianiline (CAS: 1141-88-4), it is crucial to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...