Compound Q&A

How is 2,2'-Disulfanediyldianiline (CAS: 1141-88-4) typically synthesized?

Answer

2,2'-Disulfanediyldianiline
2,2'-Disulfanediyldianiline (CAS: 1141-88-4) is typically synthesized through the reaction of aniline with sulfur dioxide in the presence of a catalyst, such as aluminum chloride or aluminum sulfate. The reaction involves the sulfonation of aniline followed by coupling, leading to the formation of the disulfide aniline derivative. The yield and selectivity can be improved by optimizing reaction conditions, such as temperature, concentration, and catalyst choice.

About

CAS No 1141-88-4
English Name 2,2'-Disulfanediyldianiline
Molecular Formula C12H12N2S2
Molecular Weight 248.38 g/mol
SMILES C1=CC=C(C(=C1)N)SSC2=CC=CC=C2N
InChIKey YYYOQURZQWIILK-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2'-Disulfanediyldianiline (CAS: 1141-88-4)?

2,2'-Disulfanediyldianiline (CAS: 1141-88-4) is a white to light yellow crystalline solid with a mol...

Compound Q&A

What industries use 2,2'-Disulfanediyldianiline (CAS: 1141-88-4)?

2,2'-Disulfanediyldianiline (CAS: 1141-88-4) is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2,2'-Disulfanediyldianiline (CAS: 1141-88-4)?

When handling 2,2'-Disulfanediyldianiline (CAS: 1141-88-4), it is crucial to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...