Compound Q&A

What industries use Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0)?

Answer

Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate
Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly in the development of antiviral and anti-inflammatory drugs. Additionally, it serves as a building block in the production of polymers with specific thermal and mechanical properties. It is also utilized in the preparation of sensors and in the semiconductor industry for its unique electronic properties.

About

English Name Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate
Molecular Formula C18H17NO3
Molecular Weight 295.34 g/mol
SMILES CCOC(=O)C1=NOC(C1)(C2=CC=CC=C2)C3=CC=CC=C3
InChIKey MWKVXOJATACCCH-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0)?

Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate is a crystalline compound with a molecular ...

Compound Q&A

How is Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0) typically synthesized?

Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate is typically synthesized from ethyl 3-carba...

Compound Q&A

What precautions should be taken when handling Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0)?

When handling Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate, it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...