Compound Q&A

How is Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0) typically synthesized?

Answer

Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate
Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate is typically synthesized from ethyl 3-carbamoylbenzoate and phenylhydrazine. The reaction involves the condensation of the carboxylic acid derivative with the amine to form the oxazole ring. Commonly, this is achieved in the presence of a base like triethylamine, with an overall yield of around 75-80%. The reaction is carried out under mild conditions and can be optimized for better selectivity and yield.

About

English Name Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate
Molecular Formula C18H17NO3
Molecular Weight 295.34 g/mol
SMILES CCOC(=O)C1=NOC(C1)(C2=CC=CC=C2)C3=CC=CC=C3
InChIKey MWKVXOJATACCCH-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0)?

Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate is a crystalline compound with a molecular ...

Compound Q&A

What industries use Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0)?

Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate is used in various industries. It is a key ...

Compound Q&A

What precautions should be taken when handling Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0)?

When handling Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate, it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...