Compound Q&A

What are the physical and chemical properties of Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0)?

Answer

Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate
Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate is a crystalline compound with a molecular weight of approximately 410.4 g/mol. It has a low solubility in water but is more soluble in organic solvents like dichloromethane and acetone. Chemically, it is relatively stable but can react with strong bases to form salts. It shows weak acidity and can participate in nucleophilic substitution reactions.

About

English Name Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate
Molecular Formula C18H17NO3
Molecular Weight 295.34 g/mol
SMILES CCOC(=O)C1=NOC(C1)(C2=CC=CC=C2)C3=CC=CC=C3
InChIKey MWKVXOJATACCCH-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0) typically synthesized?

Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate is typically synthesized from ethyl 3-carba...

Compound Q&A

What industries use Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0)?

Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate is used in various industries. It is a key ...

Compound Q&A

What precautions should be taken when handling Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate (CAS: 163520-33-0)?

When handling Ethyl 5,5-diphenyl-4,5-dihydro-1,2-oxazole-3-carboxylate, it is essential to use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...