Compound Q&A

What industries use 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1)?

Answer

2,3,5,6-Tetrachloropyridine
2,3,5,6-Tetrachloropyridine is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is also utilized in the semiconductor industry for manufacturing photolithography resist materials, and in the polymer industry for the production of flame-retardant polymers. Additionally, it has applications in the sensor industry due to its potential as a chemical sensor.

About

CAS No 2402-79-1
English Name 2,3,5,6-Tetrachloropyridine
Molecular Formula C5HCl4N
Molecular Weight 216.88 g/mol
SMILES C1=C(C(=NC(=C1Cl)Cl)Cl)Cl
InChIKey FATBKZJZAHWCSL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1)?

2,3,5,6-Tetrachloropyridine is a white crystalline solid with a molecular weight of 255.01 g/mol. It...

Compound Q&A

How is 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1) typically synthesized?

2,3,5,6-Tetrachloropyridine is typically synthesized by the chlorination of 2,3,5,6-tetrahydroxy pyr...

Compound Q&A

What precautions should be taken when handling 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1)?

When handling 2,3,5,6-Tetrachloropyridine, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...