Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1)?

Answer

2,3,5,6-Tetrachloropyridine
2,3,5,6-Tetrachloropyridine is a white crystalline solid with a molecular weight of 255.01 g/mol. It is slightly soluble in water but more soluble in organic solvents. It exhibits moderate reactivity, mainly towards nucleophilic substitution reactions. The compound is stable under normal conditions but should be handled with care due to its chlorinated nature.

About

CAS No 2402-79-1
English Name 2,3,5,6-Tetrachloropyridine
Molecular Formula C5HCl4N
Molecular Weight 216.88 g/mol
SMILES C1=C(C(=NC(=C1Cl)Cl)Cl)Cl
InChIKey FATBKZJZAHWCSL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1) typically synthesized?

2,3,5,6-Tetrachloropyridine is typically synthesized by the chlorination of 2,3,5,6-tetrahydroxy pyr...

Compound Q&A

What industries use 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1)?

2,3,5,6-Tetrachloropyridine is primarily used in the pharmaceutical industry for the synthesis of ce...

Compound Q&A

What precautions should be taken when handling 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1)?

When handling 2,3,5,6-Tetrachloropyridine, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...