Compound Q&A

How is 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1) typically synthesized?

Answer

2,3,5,6-Tetrachloropyridine
2,3,5,6-Tetrachloropyridine is typically synthesized by the chlorination of 2,3,5,6-tetrahydroxy pyridine using thionyl chloride. The reaction yields 2,3,5,6-tetrachloropyridine with good selectivity and moderate yield, often requiring purification steps to remove impurities.

About

CAS No 2402-79-1
English Name 2,3,5,6-Tetrachloropyridine
Molecular Formula C5HCl4N
Molecular Weight 216.88 g/mol
SMILES C1=C(C(=NC(=C1Cl)Cl)Cl)Cl
InChIKey FATBKZJZAHWCSL-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1)?

2,3,5,6-Tetrachloropyridine is a white crystalline solid with a molecular weight of 255.01 g/mol. It...

Compound Q&A

What industries use 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1)?

2,3,5,6-Tetrachloropyridine is primarily used in the pharmaceutical industry for the synthesis of ce...

Compound Q&A

What precautions should be taken when handling 2,3,5,6-Tetrachloropyridine (CAS: 2402-79-1)?

When handling 2,3,5,6-Tetrachloropyridine, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...