Compound Q&A

What industries use (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8)?

Answer

(9E,12E,15E)-9,12,15-Octadecatrienoic acid
(9E,12E,15E)-9,12,15-Octadecatrienoic acid finds applications in various industries. Its use in the pharmaceutical sector includes as a precursor for drug synthesis. In the polymer industry, it serves as an additive for enhancing the mechanical properties of polymers. Additionally, it is utilized in the manufacturing of sensors and as a component in semiconductors for its unique electronic properties.

About

CAS No 68132-21-8
English Name (9E,12E,15E)-9,12,15-Octadecatrienoic acid
Molecular Formula C18H30O2
Molecular Weight 278.44 g/mol
EINECS 639-680-4
SMILES CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O
InChIKey DTOSIQBPPRVQHS-IUQGRGSQSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8)?

(9E,12E,15E)-9,12,15-Octadecatrienoic acid is a solid crystalline compound with a molecular weight o...

Compound Q&A

How is (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8) typically synthesized?

(9E,12E,15E)-9,12,15-Octadecatrienoic acid can be synthesized through the hydrolysis of 9,12,15-octa...

Compound Q&A

What precautions should be taken when handling (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8)?

When handling (9E,12E,15E)-9,12,15-Octadecatrienoic acid, wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...