Compound Q&A

How is (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8) typically synthesized?

Answer

(9E,12E,15E)-9,12,15-Octadecatrienoic acid
(9E,12E,15E)-9,12,15-Octadecatrienoic acid can be synthesized through the hydrolysis of 9,12,15-octadecatrienoyl chloride, an intermediate obtained from the dehydration of 9,12,15-octadecatrienoic anhydride. Alternatively, it can be produced via direct hydrogenation of 9,12,15-octadecatrienal, a process that provides good yield and selectivity for the desired cis configuration.

About

CAS No 68132-21-8
English Name (9E,12E,15E)-9,12,15-Octadecatrienoic acid
Molecular Formula C18H30O2
Molecular Weight 278.44 g/mol
EINECS 639-680-4
SMILES CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O
InChIKey DTOSIQBPPRVQHS-IUQGRGSQSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8)?

(9E,12E,15E)-9,12,15-Octadecatrienoic acid is a solid crystalline compound with a molecular weight o...

Compound Q&A

What industries use (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8)?

(9E,12E,15E)-9,12,15-Octadecatrienoic acid finds applications in various industries. Its use in the ...

Compound Q&A

What precautions should be taken when handling (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8)?

When handling (9E,12E,15E)-9,12,15-Octadecatrienoic acid, wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...