Compound Q&A

What are the physical and chemical properties of (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8)?

Answer

(9E,12E,15E)-9,12,15-Octadecatrienoic acid
(9E,12E,15E)-9,12,15-Octadecatrienoic acid is a solid crystalline compound with a molecular weight of approximately 278.43 g/mol. It has a low solubility in water (less than 1 g/L) but is more soluble in organic solvents such as ethanol and chloroform. This acid exhibits typical reactivity for carboxylic acids, including esterification and transesterification reactions.

About

CAS No 68132-21-8
English Name (9E,12E,15E)-9,12,15-Octadecatrienoic acid
Molecular Formula C18H30O2
Molecular Weight 278.4359999999999 g/mol
EINECS 639-680-4
SMILES CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O
InChIKey DTOSIQBPPRVQHS-IUQGRGSQSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8) typically synthesized?

(9E,12E,15E)-9,12,15-Octadecatrienoic acid can be synthesized through the hydrolysis of 9,12,15-octa...

Compound Q&A

What industries use (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8)?

(9E,12E,15E)-9,12,15-Octadecatrienoic acid finds applications in various industries. Its use in the ...

Compound Q&A

What precautions should be taken when handling (9E,12E,15E)-9,12,15-Octadecatrienoic acid (CAS: 68132-21-8)?

When handling (9E,12E,15E)-9,12,15-Octadecatrienoic acid, wear appropriate personal protective equip...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...