Compound Q&A

What industries use didecyl phthalate (CAS: 84-77-5)?

Answer

Didecyl phthalate
Didecyl phthalate (CAS: 84-77-5) is widely used in the polymers industry for plasticizers, in the pharmaceutical industry as a stabilizer, and in the food industry as a flavor enhancer. It is also utilized in the manufacturing of coatings, inks, and adhesives. Additionally, it has applications in the production of sensors and semiconductors due to its stability and chemical inertness.

About

CAS No 84-77-5
English Name Didecyl phthalate
Molecular Formula C28H46O4
Molecular Weight 446.67 g/mol
SMILES O=C(OCCCCCCCCCC)C1=CC=CC=C1C(OCCCCCCCCCC)=O
InChIKey PGIBJVOPLXHHGS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Didecyl phthalate (CAS: 84-77-5)?

Didecyl phthalate (CAS: 84-77-5) is a colorless to light yellow liquid with a molecular weight of ap...

Compound Q&A

How is didecyl phthalate (CAS: 84-77-5) typically synthesized?

Didecyl phthalate (CAS: 84-77-5) is typically synthesized through the esterification of phthalic anh...

Compound Q&A

What precautions should be taken when handling didecyl phthalate (CAS: 84-77-5)?

When handling didecyl phthalate (CAS: 84-77-5), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...