Compound Q&A

What are the physical and chemical properties of Didecyl phthalate (CAS: 84-77-5)?

Answer

Didecyl phthalate
Didecyl phthalate (CAS: 84-77-5) is a colorless to light yellow liquid with a molecular weight of approximately 344.46 g/mol. It has a high boiling point (290-295°C) and low solubility in water (0.5 g/100 mL at 20°C). It is slightly soluble in ethanol and readily soluble in organic solvents such as toluene. It exhibits low reactivity under normal conditions but can degrade under prolonged exposure to heat or light.

About

CAS No 84-77-5
English Name Didecyl phthalate
Molecular Formula C28H46O4
Molecular Weight 446.67 g/mol
SMILES O=C(OCCCCCCCCCC)C1=CC=CC=C1C(OCCCCCCCCCC)=O
InChIKey PGIBJVOPLXHHGS-UHFFFAOYSA-N
Last Updated: 2025-09-07 10:18

Related Q&A

Compound Q&A

How is didecyl phthalate (CAS: 84-77-5) typically synthesized?

Didecyl phthalate (CAS: 84-77-5) is typically synthesized through the esterification of phthalic anh...

Compound Q&A

What industries use didecyl phthalate (CAS: 84-77-5)?

Didecyl phthalate (CAS: 84-77-5) is widely used in the polymers industry for plasticizers, in the ph...

Compound Q&A

What precautions should be taken when handling didecyl phthalate (CAS: 84-77-5)?

When handling didecyl phthalate (CAS: 84-77-5), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...